C24H26N2OS2 — CID 54502674
3-(1,3-benzothiazol-2-yl)-7-(dibutylamino)chromene-2-thione (PubChem CID 54502674) has the molecular formula C24H26N2OS2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(dibutylamino)chromene-2-thione.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(dibutylamino)chromene-2-thione |
|---|---|
| PubChem CID | 54502674 |
| Molecular Formula | C24H26N2OS2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(dibutylamino)chromene-2-thione |
| SMILES | CCCCN(CCCC)c1ccc2cc(-c3nc4ccccc4s3)c(=S)oc2c1 |
| InChI | InChI=1S/C24H26N2OS2/c1-3-5-13-26(14-6-4-2)18-12-11-17-15-19(24(28)27-21(17)16-18)23-25-20-9-7-8-10-22(20)29-23/h7-12,15-16H,3-6,13-14H2,1-2H3 |
| InChIKey | YDNVDIAFASVLSQ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|