C21H20N2O2S — CID 162774158
3-(1,3-benzothiazol-2-yl)-7-(pentylamino)chromen-2-one (PubChem CID 162774158) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(pentylamino)chromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(pentylamino)chromen-2-one |
|---|---|
| PubChem CID | 162774158 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(pentylamino)chromen-2-one |
| SMILES | CCCCCNc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H20N2O2S/c1-2-3-6-11-22-15-10-9-14-12-16(21(24)25-18(14)13-15)20-23-17-7-4-5-8-19(17)26-20/h4-5,7-10,12-13,22H,2-3,6,11H2,1H3 |
| InChIKey | JJIUTQXEYPNOSS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|