C25H16N4O2S — CID 88742087
3-(1,3-benzothiazol-2-yl)-7-(4-methyl-5-phenyltriazol-2-yl)chromen-2-one (PubChem CID 88742087) has the molecular formula C25H16N4O2S and a molecular weight of 436.50 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(4-methyl-5-phenyltriazol-2-yl)chromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(4-methyl-5-phenyltriazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 88742087 |
| Molecular Formula | C25H16N4O2S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(4-methyl-5-phenyltriazol-2-yl)chromen-2-one |
| SMILES | Cc1nn(-c2ccc3cc(-c4nc5ccccc5s4)c(=O)oc3c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H16N4O2S/c1-15-23(16-7-3-2-4-8-16)28-29(27-15)18-12-11-17-13-19(25(30)31-21(17)14-18)24-26-20-9-5-6-10-22(20)32-24/h2-14H,1H3 |
| InChIKey | NWXFWVJHCFRMAW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|