C18H19N3O6S2 — CID 162687722
2-[4-methyl-2-[2-oxo-7-(3-sulfamoylpropylamino)chromen-3-yl]-1,3-thiazol-5-yl]acetic acid (PubChem CID 162687722) has the molecular formula C18H19N3O6S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[4-methyl-2-[2-oxo-7-(3-sulfamoylpropylamino)chromen-3-yl]-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[4-methyl-2-[2-oxo-7-(3-sulfamoylpropylamino)chromen-3-yl]-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 162687722 |
| Molecular Formula | C18H19N3O6S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-[4-methyl-2-[2-oxo-7-(3-sulfamoylpropylamino)chromen-3-yl]-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(-c2cc3ccc(NCCCS(N)(=O)=O)cc3oc2=O)sc1CC(=O)O |
| InChI | InChI=1S/C18H19N3O6S2/c1-10-15(9-16(22)23)28-17(21-10)13-7-11-3-4-12(8-14(11)27-18(13)24)20-5-2-6-29(19,25)26/h3-4,7-8,20H,2,5-6,9H2,1H3,(H,22,23)(H2,19,25,26) |
| InChIKey | MVADSDNUEKRECO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|