C12H9Cl2NO2S — CID 81492328
2-[2-(3,4-dichlorophenyl)-4-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 81492328) has the molecular formula C12H9Cl2NO2S and a molecular weight of 302.18 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-4-methyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(3,4-dichlorophenyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 81492328 |
| Molecular Formula | C12H9Cl2NO2S |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(-c2ccc(Cl)c(Cl)c2)sc1CC(=O)O |
| InChI | InChI=1S/C12H9Cl2NO2S/c1-6-10(5-11(16)17)18-12(15-6)7-2-3-8(13)9(14)4-7/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | LMTQGKBUVPTVQF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |