C11H10Cl2N2O2S — CID 82545832
2-(3-amino-4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride (PubChem CID 82545832) has the molecular formula C11H10Cl2N2O2S and a molecular weight of 305.19 g/mol. Its IUPAC name is 2-(3-amino-4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride.
| Compound Name | 2-(3-amino-4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 82545832 |
| Molecular Formula | C11H10Cl2N2O2S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 2-(3-amino-4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride |
| SMILES | Cc1nc(-c2ccc(Cl)c(N)c2)sc1C(=O)O.Cl |
| InChI | InChI=1S/C11H9ClN2O2S.ClH/c1-5-9(11(15)16)17-10(14-5)6-2-3-7(12)8(13)4-6;/h2-4H,13H2,1H3,(H,15,16);1H |
| InChIKey | RPSWCEGWMKYJCT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|