C15H10F2N2O2S — CID 89076614
2-(4-amino-5,6-difluoronaphthalen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 89076614) has the molecular formula C15H10F2N2O2S and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-(4-amino-5,6-difluoronaphthalen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-amino-5,6-difluoronaphthalen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 89076614 |
| Molecular Formula | C15H10F2N2O2S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-(4-amino-5,6-difluoronaphthalen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2cc(N)c3c(F)c(F)ccc3c2)sc1C(=O)O |
| InChI | InChI=1S/C15H10F2N2O2S/c1-6-13(15(20)21)22-14(19-6)8-4-7-2-3-9(16)12(17)11(7)10(18)5-8/h2-5H,18H2,1H3,(H,20,21) |
| InChIKey | GPQYTKBXGSPPSK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|