C12H11FN2O3 — CID 163723697
7-(fluoromethylamino)-N-methyl-2-oxochromene-3-carboxamide (PubChem CID 163723697) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 7-(fluoromethylamino)-N-methyl-2-oxochromene-3-carboxamide.
| Compound Name | 7-(fluoromethylamino)-N-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 163723697 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 7-(fluoromethylamino)-N-methyl-2-oxochromene-3-carboxamide |
| SMILES | CNC(=O)c1cc2ccc(NCF)cc2oc1=O |
| InChI | InChI=1S/C12H11FN2O3/c1-14-11(16)9-4-7-2-3-8(15-6-13)5-10(7)18-12(9)17/h2-5,15H,6H2,1H3,(H,14,16) |
| InChIKey | KTUIJVGIZMJTID-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|