C33H33N3O6 — CID 153429304
[[2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl]amino]methyl 2-methylprop-2-enoate (PubChem CID 153429304) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is [[2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl]amino]methyl 2-methylprop-2-enoate.
| Compound Name | [[2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl]amino]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153429304 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | [[2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl]amino]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)OCNc1ccc(CCc2ccc(NC(=O)c3cc4ccc(NCOC(=O)C(=C)C)cc4oc3=O)cc2)cc1 |
| InChI | InChI=1S/C33H33N3O6/c1-21(2)32(38)41-20-35-28-16-11-25-17-29(33(39)42-30(25)18-28)31(37)36-27-14-9-24(10-15-27)6-5-23-7-12-26(13-8-23)34-19-40-22(3)4/h7-18,34-35H,1,3,5-6,19-20H2,2,4H3,(H,36,37) |
| InChIKey | PFRZMRXSHYUBNY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|