C31H29N3O6 — CID 153429290
N-[4-[2-[4-(ethenoxymethylamino)phenyl]ethyl]phenyl]-2-oxo-7-[(prop-2-enoylamino)methoxy]chromene-3-carboxamide (PubChem CID 153429290) has the molecular formula C31H29N3O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is N-[4-[2-[4-(ethenoxymethylamino)phenyl]ethyl]phenyl]-2-oxo-7-[(prop-2-enoylamino)methoxy]chromene-3-carboxamide.
| Compound Name | N-[4-[2-[4-(ethenoxymethylamino)phenyl]ethyl]phenyl]-2-oxo-7-[(prop-2-enoylamino)methoxy]chromene-3-carboxamide |
|---|---|
| PubChem CID | 153429290 |
| Molecular Formula | C31H29N3O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[4-[2-[4-(ethenoxymethylamino)phenyl]ethyl]phenyl]-2-oxo-7-[(prop-2-enoylamino)methoxy]chromene-3-carboxamide |
| SMILES | C=COCNc1ccc(CCc2ccc(NC(=O)c3cc4ccc(OCNC(=O)C=C)cc4oc3=O)cc2)cc1 |
| InChI | InChI=1S/C31H29N3O6/c1-3-29(35)33-20-39-26-16-11-23-17-27(31(37)40-28(23)18-26)30(36)34-25-14-9-22(10-15-25)6-5-21-7-12-24(13-8-21)32-19-38-4-2/h3-4,7-18,32H,1-2,5-6,19-20H2,(H,33,35)(H,34,36) |
| InChIKey | OFYCACIWCOHVDG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|