C27H23NO5 — CID 101461531
7-[(4-ethenylphenyl)methoxy]-N-[4-(2-hydroxyethyl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 101461531) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 7-[(4-ethenylphenyl)methoxy]-N-[4-(2-hydroxyethyl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 7-[(4-ethenylphenyl)methoxy]-N-[4-(2-hydroxyethyl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 101461531 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 7-[(4-ethenylphenyl)methoxy]-N-[4-(2-hydroxyethyl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | C=Cc1ccc(COc2ccc3cc(C(=O)Nc4ccc(CCO)cc4)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-2-18-3-5-20(6-4-18)17-32-23-12-9-21-15-24(27(31)33-25(21)16-23)26(30)28-22-10-7-19(8-11-22)13-14-29/h2-12,15-16,29H,1,13-14,17H2,(H,28,30) |
| InChIKey | WTBHQWPZZCVAAF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|