C32H30N2O6 — CID 153429300
[2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl] 2-methylprop-2-enoate (PubChem CID 153429300) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is [2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl] 2-methylprop-2-enoate.
| Compound Name | [2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153429300 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [2-oxo-3-[[4-[2-[4-(prop-1-en-2-yloxymethylamino)phenyl]ethyl]phenyl]carbamoyl]chromen-7-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)OCNc1ccc(CCc2ccc(NC(=O)c3cc4ccc(OC(=O)C(=C)C)cc4oc3=O)cc2)cc1 |
| InChI | InChI=1S/C32H30N2O6/c1-20(2)31(36)39-27-16-11-24-17-28(32(37)40-29(24)18-27)30(35)34-26-14-9-23(10-15-26)6-5-22-7-12-25(13-8-22)33-19-38-21(3)4/h7-18,33H,1,3,5-6,19H2,2,4H3,(H,34,35) |
| InChIKey | FDPPCIGDDPLOTP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|