C17H17N3O2S — CID 71622539
3-(4-methyl-1,3-thiazol-2-yl)-7-piperazin-1-ylchromen-2-one (PubChem CID 71622539) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-2-yl)-7-piperazin-1-ylchromen-2-one.
| Compound Name | 3-(4-methyl-1,3-thiazol-2-yl)-7-piperazin-1-ylchromen-2-one |
|---|---|
| PubChem CID | 71622539 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-2-yl)-7-piperazin-1-ylchromen-2-one |
| SMILES | Cc1csc(-c2cc3ccc(N4CCNCC4)cc3oc2=O)n1 |
| InChI | InChI=1S/C17H17N3O2S/c1-11-10-23-16(19-11)14-8-12-2-3-13(9-15(12)22-17(14)21)20-6-4-18-5-7-20/h2-3,8-10,18H,4-7H2,1H3 |
| InChIKey | HFZKTRBUMNZFAO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|