C25H23N5O2 — CID 121307826
6-methyl-5-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one (PubChem CID 121307826) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 6-methyl-5-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one.
| Compound Name | 6-methyl-5-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
|---|---|
| PubChem CID | 121307826 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 6-methyl-5-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| SMILES | Cc1nnc(-c2cccc(-c3c(C)c4cc5c6c(c4oc3=O)CCCN6CCC5)c2)nn1 |
| InChI | InChI=1S/C25H23N5O2/c1-14-20-13-17-8-4-10-30-11-5-9-19(22(17)30)23(20)32-25(31)21(14)16-6-3-7-18(12-16)24-28-26-15(2)27-29-24/h3,6-7,12-13H,4-5,8-11H2,1-2H3 |
| InChIKey | LNFKZNDSLGTLTM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|