C25H27N3O5 — CID 3365602
1-butyl-5-[(6-methyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3365602) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-butyl-5-[(6-methyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-butyl-5-[(6-methyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3365602 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-butyl-5-[(6-methyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCN1C(=O)NC(=O)C(=Cc2c(C)c3cc4c5c(c3oc2=O)CCCN5CCC4)C1=O |
| InChI | InChI=1S/C25H27N3O5/c1-3-4-11-28-23(30)19(22(29)26-25(28)32)13-18-14(2)17-12-15-7-5-9-27-10-6-8-16(20(15)27)21(17)33-24(18)31/h12-13H,3-11H2,1-2H3,(H,26,29,32) |
| InChIKey | OXNILVZGXRXCIQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|