C21H21N2O2+ — CID 87648971
5-(1-methylpyridin-1-ium-4-yl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 87648971) has the molecular formula C21H21N2O2+ and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-(1-methylpyridin-1-ium-4-yl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-(1-methylpyridin-1-ium-4-yl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 87648971 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-(1-methylpyridin-1-ium-4-yl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | C[n+]1ccc(-c2cc3cc4c5c(c3oc2=O)CCCN5CCC4)cc1 |
| InChI | InChI=1S/C21H21N2O2/c1-22-10-6-14(7-11-22)18-13-16-12-15-4-2-8-23-9-3-5-17(19(15)23)20(16)25-21(18)24/h6-7,10-13H,2-5,8-9H2,1H3/q+1 |
| InChIKey | RDZIPAHQARXLKH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|