C25H30N2O4 — CID 122233952
5-[2-(2,2-dimethylpropanoyl)pyrrolidine-1-carbonyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 122233952) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-[2-(2,2-dimethylpropanoyl)pyrrolidine-1-carbonyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-[2-(2,2-dimethylpropanoyl)pyrrolidine-1-carbonyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 122233952 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-[2-(2,2-dimethylpropanoyl)pyrrolidine-1-carbonyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC(C)(C)C(=O)C1CCCN1C(=O)c1cc2cc3c4c(c2oc1=O)CCCN4CCC3 |
| InChI | InChI=1S/C25H30N2O4/c1-25(2,3)22(28)19-9-6-12-27(19)23(29)18-14-16-13-15-7-4-10-26-11-5-8-17(20(15)26)21(16)31-24(18)30/h13-14,19H,4-12H2,1-3H3 |
| InChIKey | JPPGTZODDZHQLZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|