C29H32N4O4 — CID 122233950
N-[4-(dimethylamino)phenyl]-1-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 122233950) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-1-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-1-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122233950 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-1-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CCCN2C(=O)c2cc3cc4c5c(c3oc2=O)CCCN5CCC4)cc1 |
| InChI | InChI=1S/C29H32N4O4/c1-31(2)21-11-9-20(10-12-21)30-27(34)24-8-5-15-33(24)28(35)23-17-19-16-18-6-3-13-32-14-4-7-22(25(18)32)26(19)37-29(23)36/h9-12,16-17,24H,3-8,13-15H2,1-2H3,(H,30,34) |
| InChIKey | HHIRCALPSMBJKX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|