C24H25N3O2 — CID 2135724
N-(3,4-dimethylphenyl)-4-imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide (PubChem CID 2135724) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 2135724 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
| SMILES | [H]/N=c1\oc2c3c4c(cc2cc1C(=O)Nc1ccc(C)c(C)c1)CCCN4CCC3 |
| InChI | InChI=1S/C24H25N3O2/c1-14-7-8-18(11-15(14)2)26-24(28)20-13-17-12-16-5-3-9-27-10-4-6-19(21(16)27)22(17)29-23(20)25/h7-8,11-13,25H,3-6,9-10H2,1-2H3,(H,26,28)/b25-23- |
| InChIKey | FCMSCFOAKUCLTG-BZZOAKBMSA-N |
| XLogP | 4.48 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |