C30H29N3O3 — CID 46254721
N-(2-methoxyphenyl)-4-(2-methylphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide (PubChem CID 46254721) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-(2-methylphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-4-(2-methylphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 46254721 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-(2-methoxyphenyl)-4-(2-methylphenyl)imino-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2cc3c4c(c2o/c1=N\c1ccccc1C)CCCN4CCC3 |
| InChI | InChI=1S/C30H29N3O3/c1-19-9-3-4-12-24(19)32-30-23(29(34)31-25-13-5-6-14-26(25)35-2)18-21-17-20-10-7-15-33-16-8-11-22(27(20)33)28(21)36-30/h3-6,9,12-14,17-18H,7-8,10-11,15-16H2,1-2H3,(H,31,34)/b32-30- |
| InChIKey | IWDRUJPWXAAZKP-GCUVURNUSA-N |
| XLogP | 5.93 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |