C25H22N2O2 — CID 51370469
N-(2,4-dimethylphenyl)-2-(2-methylphenyl)iminochromene-3-carboxamide (PubChem CID 51370469) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(2-methylphenyl)iminochromene-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(2-methylphenyl)iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 51370469 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(2-methylphenyl)iminochromene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3o/c2=N\c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C25H22N2O2/c1-16-12-13-22(18(3)14-16)26-24(28)20-15-19-9-5-7-11-23(19)29-25(20)27-21-10-6-4-8-17(21)2/h4-15H,1-3H3,(H,26,28)/b27-25- |
| InChIKey | GJXCKCOVLHEBPV-RFBIWTDZSA-N |
| XLogP | 5.84 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |