C25H22N2O3 — CID 986292
2-(2,3-dimethylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide (PubChem CID 986292) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide.
| Compound Name | 2-(2,3-dimethylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 986292 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-(2,3-dimethylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3o/c2=N\c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-16-7-6-9-22(17(16)2)27-25-21(15-18-8-4-5-10-23(18)30-25)24(28)26-19-11-13-20(29-3)14-12-19/h4-15H,1-3H3,(H,26,28)/b27-25- |
| InChIKey | SONXHNLMJBLYGP-RFBIWTDZSA-N |
| XLogP | 5.54 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |