C24H19N3O4 — CID 51368024
2-(4-carbamoylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide (PubChem CID 51368024) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-(4-carbamoylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide.
| Compound Name | 2-(4-carbamoylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 51368024 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-(4-carbamoylphenyl)imino-N-(4-methoxyphenyl)chromene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3o/c2=N\c2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C24H19N3O4/c1-30-19-12-10-17(11-13-19)26-23(29)20-14-16-4-2-3-5-21(16)31-24(20)27-18-8-6-15(7-9-18)22(25)28/h2-14H,1H3,(H2,25,28)(H,26,29)/b27-24- |
| InChIKey | HKFQISUBSQZOOS-PNHLSOANSA-N |
| XLogP | 4.03 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |