C18H15N3O4 — CID 3459938
2-[(4-methoxybenzoyl)hydrazinylidene]chromene-3-carboxamide (PubChem CID 3459938) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)hydrazinylidene]chromene-3-carboxamide.
| Compound Name | 2-[(4-methoxybenzoyl)hydrazinylidene]chromene-3-carboxamide |
|---|---|
| PubChem CID | 3459938 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[(4-methoxybenzoyl)hydrazinylidene]chromene-3-carboxamide |
| SMILES | COc1ccc(C(=O)NN=c2oc3ccccc3cc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H15N3O4/c1-24-13-8-6-11(7-9-13)17(23)20-21-18-14(16(19)22)10-12-4-2-3-5-15(12)25-18/h2-10H,1H3,(H2,19,22)(H,20,23) |
| InChIKey | SUYZCPJCIOTLHK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|