C17H12FN3O3 — CID 5186461
2-[(4-fluorobenzoyl)hydrazinylidene]chromene-3-carboxamide (PubChem CID 5186461) has the molecular formula C17H12FN3O3 and a molecular weight of 325.30 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)hydrazinylidene]chromene-3-carboxamide.
| Compound Name | 2-[(4-fluorobenzoyl)hydrazinylidene]chromene-3-carboxamide |
|---|---|
| PubChem CID | 5186461 |
| Molecular Formula | C17H12FN3O3 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[(4-fluorobenzoyl)hydrazinylidene]chromene-3-carboxamide |
| SMILES | NC(=O)c1cc2ccccc2oc1=NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12FN3O3/c18-12-7-5-10(6-8-12)16(23)20-21-17-13(15(19)22)9-11-3-1-2-4-14(11)24-17/h1-9H,(H2,19,22)(H,20,23) |
| InChIKey | UOXKAYPWDWMEAO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|