C18H14N4O6 — CID 3576903
6-methoxy-2-[(4-nitrobenzoyl)hydrazinylidene]chromene-3-carboxamide (PubChem CID 3576903) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is 6-methoxy-2-[(4-nitrobenzoyl)hydrazinylidene]chromene-3-carboxamide.
| Compound Name | 6-methoxy-2-[(4-nitrobenzoyl)hydrazinylidene]chromene-3-carboxamide |
|---|---|
| PubChem CID | 3576903 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 6-methoxy-2-[(4-nitrobenzoyl)hydrazinylidene]chromene-3-carboxamide |
| SMILES | COc1ccc2oc(=NNC(=O)c3ccc([N+](=O)[O-])cc3)c(C(N)=O)cc2c1 |
| InChI | InChI=1S/C18H14N4O6/c1-27-13-6-7-15-11(8-13)9-14(16(19)23)18(28-15)21-20-17(24)10-2-4-12(5-3-10)22(25)26/h2-9H,1H3,(H2,19,23)(H,20,24) |
| InChIKey | PCHBTTVVXZHSMM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|