C16H13N3O5 — CID 5201553
2-(furan-2-carbonylhydrazinylidene)-7-methoxychromene-3-carboxamide (PubChem CID 5201553) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-(furan-2-carbonylhydrazinylidene)-7-methoxychromene-3-carboxamide.
| Compound Name | 2-(furan-2-carbonylhydrazinylidene)-7-methoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 5201553 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(furan-2-carbonylhydrazinylidene)-7-methoxychromene-3-carboxamide |
| SMILES | COc1ccc2cc(C(N)=O)c(=NNC(=O)c3ccco3)oc2c1 |
| InChI | InChI=1S/C16H13N3O5/c1-22-10-5-4-9-7-11(14(17)20)16(24-13(9)8-10)19-18-15(21)12-3-2-6-23-12/h2-8H,1H3,(H2,17,20)(H,18,21) |
| InChIKey | ROEVQSIWTPKKIA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|