C15H16N2O4 — CID 9175469
N-[(Z)-1-(2,5-dimethoxyphenyl)ethylideneamino]furan-2-carboxamide (PubChem CID 9175469) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)ethylideneamino]furan-2-carboxamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 9175469 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)ethylideneamino]furan-2-carboxamide |
| SMILES | COc1ccc(OC)c(/C(C)=N\NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C15H16N2O4/c1-10(16-17-15(18)14-5-4-8-21-14)12-9-11(19-2)6-7-13(12)20-3/h4-9H,1-3H3,(H,17,18)/b16-10- |
| InChIKey | DMWDVAZLRFOFRV-YBEGLDIGSA-N |
| XLogP | 2.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|