C11H8Cl2N2O2S — CID 5412328
N-[(E)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]furan-2-carboxamide (PubChem CID 5412328) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 5412328 |
| Molecular Formula | C11H8Cl2N2O2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | N-[(E)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]furan-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccco1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H8Cl2N2O2S/c1-6(7-5-9(12)18-10(7)13)14-15-11(16)8-3-2-4-17-8/h2-5H,1H3,(H,15,16)/b14-6+ |
| InChIKey | KKDCZJUCXDSDBY-MKMNVTDBSA-N |
| XLogP | 3.80 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|