C13H12N2O4 — CID 135644319
N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]furan-2-carboxamide (PubChem CID 135644319) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 135644319 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]furan-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccco1)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H12N2O4/c1-8(10-5-4-9(16)7-11(10)17)14-15-13(18)12-3-2-6-19-12/h2-7,16-17H,1H3,(H,15,18)/b14-8+ |
| InChIKey | PLIOYYRNVQUDIU-RIYZIHGNSA-N |
| XLogP | 1.84 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|