C15H14Cl2N2OS2 — CID 6383516
N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 6383516) has the molecular formula C15H14Cl2N2OS2 and a molecular weight of 373.33 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 6383516 |
| Molecular Formula | C15H14Cl2N2OS2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1csc2c1CCCC2)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C15H14Cl2N2OS2/c1-8(10-6-13(16)22-14(10)17)18-19-15(20)11-7-21-12-5-3-2-4-9(11)12/h6-7H,2-5H2,1H3,(H,19,20)/b18-8- |
| InChIKey | SSQZCNJROPPIMK-LSCVHKIXSA-N |
| XLogP | 5.15 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|