C22H20ClN3O2S2 — CID 5013052
N-[1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5013052) has the molecular formula C22H20ClN3O2S2 and a molecular weight of 458.01 g/mol. Its IUPAC name is N-[1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5013052 |
| Molecular Formula | C22H20ClN3O2S2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(=NNC(=O)c1csc2c1CCCC2)c1cccc(NC(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C22H20ClN3O2S2/c1-13(25-26-21(27)17-12-29-18-8-3-2-7-16(17)18)14-5-4-6-15(11-14)24-22(28)19-9-10-20(23)30-19/h4-6,9-12H,2-3,7-8H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | FYUFCHVBRQHLHP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|