C23H21NOS — CID 34239469
N-[3-[(Z)-2-phenylethenyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 34239469) has the molecular formula C23H21NOS and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[3-[(Z)-2-phenylethenyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[3-[(Z)-2-phenylethenyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 34239469 |
| Molecular Formula | C23H21NOS |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[3-[(Z)-2-phenylethenyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc(/C=C\c2ccccc2)c1)c1csc2c1CCCC2 |
| InChI | InChI=1S/C23H21NOS/c25-23(21-16-26-22-12-5-4-11-20(21)22)24-19-10-6-9-18(15-19)14-13-17-7-2-1-3-8-17/h1-3,6-10,13-16H,4-5,11-12H2,(H,24,25)/b14-13- |
| InChIKey | OVOIRCNZBHNKQI-YPKPFQOOSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|