C18H22N4O5S — CID 71477345
ethyl 2,4-diamino-5-[[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]carbamoyl]thiophene-3-carboxylate (PubChem CID 71477345) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 2,4-diamino-5-[[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]carbamoyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2,4-diamino-5-[[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]carbamoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 71477345 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | ethyl 2,4-diamino-5-[[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]carbamoyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)N/N=C(\C)c2cc(OC)ccc2OC)c1N |
| InChI | InChI=1S/C18H22N4O5S/c1-5-27-18(24)13-14(19)15(28-16(13)20)17(23)22-21-9(2)11-8-10(25-3)6-7-12(11)26-4/h6-8H,5,19-20H2,1-4H3,(H,22,23)/b21-9+ |
| InChIKey | ICOLMMQTHOLUAC-ZVBGSRNCSA-N |
| XLogP | 2.26 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|