C26H27N3O4 — CID 41244021
N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide (PubChem CID 41244021) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide.
| Compound Name | N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide |
|---|---|
| PubChem CID | 41244021 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide |
| SMILES | COc1ccc(OC)c(/C(C)=N/NC(=O)CCC(=O)N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-19(23-18-22(32-2)14-15-24(23)33-3)27-28-25(30)16-17-26(31)29(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-15,18H,16-17H2,1-3H3,(H,28,30)/b27-19+ |
| InChIKey | WHQGFFLJEOOHKP-ZXVVBBHZSA-N |
| XLogP | 4.69 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|