C26H27N3O4 — CID 3805270
N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 3805270) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3805270 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(C(C)=NNC(=O)CNC(=O)C(c2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-18(22-15-14-21(32-2)16-23(22)33-3)28-29-24(30)17-27-26(31)25(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-16,25H,17H2,1-3H3,(H,27,31)(H,29,30) |
| InChIKey | HVLNRJAOUSRBIX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|