C19H20FN3O4 — CID 3324224
N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 3324224) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3324224 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[2-[2-[1-(2,4-dimethoxyphenyl)ethylidene]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | COc1ccc(C(C)=NNC(=O)CNC(=O)c2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C19H20FN3O4/c1-12(14-9-8-13(26-2)10-17(14)27-3)22-23-18(24)11-21-19(25)15-6-4-5-7-16(15)20/h4-10H,11H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | GWVNKLVHIPVYIP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|