C16H22N2O5 — CID 873045
N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 873045) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 873045 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | COc1ccc(C(C)=NNC(=O)CC2(C)OCCO2)c(OC)c1 |
| InChI | InChI=1S/C16H22N2O5/c1-11(13-6-5-12(20-3)9-14(13)21-4)17-18-15(19)10-16(2)22-7-8-23-16/h5-6,9H,7-8,10H2,1-4H3,(H,18,19) |
| InChIKey | ZQWFMGUWTRRMEV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|