C15H20N2O4 — CID 5415380
N-[(Z)-1-(3-methoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 5415380) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[(Z)-1-(3-methoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[(Z)-1-(3-methoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 5415380 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[(Z)-1-(3-methoxyphenyl)ethylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | COc1cccc(/C(C)=N\NC(=O)CC2(C)OCCO2)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-11(12-5-4-6-13(9-12)19-3)16-17-14(18)10-15(2)20-7-8-21-15/h4-6,9H,7-8,10H2,1-3H3,(H,17,18)/b16-11- |
| InChIKey | LAKZOOPKXUAPCM-WJDWOHSUSA-N |
| XLogP | 1.69 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|