C23H24N2O4 — CID 8757489
(2R)-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-naphthalen-2-yloxypropanamide (PubChem CID 8757489) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2R)-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-naphthalen-2-yloxypropanamide.
| Compound Name | (2R)-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-naphthalen-2-yloxypropanamide |
|---|---|
| PubChem CID | 8757489 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R)-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-naphthalen-2-yloxypropanamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)[C@@H](C)Oc2ccc3ccccc3c2)c(OC)c1 |
| InChI | InChI=1S/C23H24N2O4/c1-15(21-12-11-19(27-3)14-22(21)28-4)24-25-23(26)16(2)29-20-10-9-17-7-5-6-8-18(17)13-20/h5-14,16H,1-4H3,(H,25,26)/b24-15-/t16-/m1/s1 |
| InChIKey | ZESLARUSHYWDLM-OYJNRBEISA-N |
| XLogP | 4.16 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|