C20H17N2O4S- — CID 8860888
5-[(Z)-C-methyl-N-[[(2S)-2-naphthalen-2-yloxypropanoyl]amino]carbonimidoyl]thiophene-2-carboxylate (PubChem CID 8860888) has the molecular formula C20H17N2O4S- and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-[(Z)-C-methyl-N-[[(2S)-2-naphthalen-2-yloxypropanoyl]amino]carbonimidoyl]thiophene-2-carboxylate.
| Compound Name | 5-[(Z)-C-methyl-N-[[(2S)-2-naphthalen-2-yloxypropanoyl]amino]carbonimidoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8860888 |
| Molecular Formula | C20H17N2O4S- |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-[(Z)-C-methyl-N-[[(2S)-2-naphthalen-2-yloxypropanoyl]amino]carbonimidoyl]thiophene-2-carboxylate |
| SMILES | C/C(=N/NC(=O)[C@H](C)Oc1ccc2ccccc2c1)c1ccc(C(=O)[O-])s1 |
| InChI | InChI=1S/C20H18N2O4S/c1-12(17-9-10-18(27-17)20(24)25)21-22-19(23)13(2)26-16-8-7-14-5-3-4-6-15(14)11-16/h3-11,13H,1-2H3,(H,22,23)(H,24,25)/p-1/b21-12-/t13-/m0/s1 |
| InChIKey | LJZGHUUVVRSUKP-KUARTLJMSA-M |
| XLogP | 2.57 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|