C16H17FN2O2S — CID 9151683
(2R)-2-(2-fluorophenoxy)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]propanamide (PubChem CID 9151683) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R)-2-(2-fluorophenoxy)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]propanamide.
| Compound Name | (2R)-2-(2-fluorophenoxy)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]propanamide |
|---|---|
| PubChem CID | 9151683 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2R)-2-(2-fluorophenoxy)-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]propanamide |
| SMILES | C/C(=N/NC(=O)[C@@H](C)Oc1ccccc1F)c1ccc(C)s1 |
| InChI | InChI=1S/C16H17FN2O2S/c1-10-8-9-15(22-10)11(2)18-19-16(20)12(3)21-14-7-5-4-6-13(14)17/h4-9,12H,1-3H3,(H,19,20)/b18-11-/t12-/m1/s1 |
| InChIKey | HZENJIPGXKLBLW-OTWJJXBCSA-N |
| XLogP | 3.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|