C13H14N4O3S — CID 6279835
(2E)-2-(carbamothioylhydrazinylidene)-7-ethoxychromene-3-carboxamide (PubChem CID 6279835) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is (2E)-2-(carbamothioylhydrazinylidene)-7-ethoxychromene-3-carboxamide.
| Compound Name | (2E)-2-(carbamothioylhydrazinylidene)-7-ethoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 6279835 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2E)-2-(carbamothioylhydrazinylidene)-7-ethoxychromene-3-carboxamide |
| SMILES | CCOc1ccc2cc(C(N)=O)/c(=N\NC(N)=S)oc2c1 |
| InChI | InChI=1S/C13H14N4O3S/c1-2-19-8-4-3-7-5-9(11(14)18)12(16-17-13(15)21)20-10(7)6-8/h3-6H,2H2,1H3,(H2,14,18)(H3,15,17,21)/b16-12+ |
| InChIKey | OIOHOERFFQMOAO-FOWTUZBSSA-N |
| XLogP | 0.58 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|