C20H19NO4 — CID 5262710
N-(2,5-dimethylphenyl)-7-ethoxy-2-oxochromene-3-carboxamide (PubChem CID 5262710) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-7-ethoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-7-ethoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 5262710 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-7-ethoxy-2-oxochromene-3-carboxamide |
| SMILES | CCOc1ccc2cc(C(=O)Nc3cc(C)ccc3C)c(=O)oc2c1 |
| InChI | InChI=1S/C20H19NO4/c1-4-24-15-8-7-14-10-16(20(23)25-18(14)11-15)19(22)21-17-9-12(2)5-6-13(17)3/h5-11H,4H2,1-3H3,(H,21,22) |
| InChIKey | ZNQXTYDRIFWZQM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|