C18H15N3O5 — CID 5263160
N'-(7-ethoxy-2-oxochromene-3-carbonyl)pyridine-4-carbohydrazide (PubChem CID 5263160) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is N'-(7-ethoxy-2-oxochromene-3-carbonyl)pyridine-4-carbohydrazide.
| Compound Name | N'-(7-ethoxy-2-oxochromene-3-carbonyl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 5263160 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N'-(7-ethoxy-2-oxochromene-3-carbonyl)pyridine-4-carbohydrazide |
| SMILES | CCOc1ccc2cc(C(=O)NNC(=O)c3ccncc3)c(=O)oc2c1 |
| InChI | InChI=1S/C18H15N3O5/c1-2-25-13-4-3-12-9-14(18(24)26-15(12)10-13)17(23)21-20-16(22)11-5-7-19-8-6-11/h3-10H,2H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZDJNDKLXELXFTE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|