C21H22BrN5O2S — CID 2316813
N-(4-bromophenyl)-2-(carbamothioylhydrazinylidene)-7-(diethylamino)chromene-3-carboxamide (PubChem CID 2316813) has the molecular formula C21H22BrN5O2S and a molecular weight of 488.41 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(carbamothioylhydrazinylidene)-7-(diethylamino)chromene-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-2-(carbamothioylhydrazinylidene)-7-(diethylamino)chromene-3-carboxamide |
|---|---|
| PubChem CID | 2316813 |
| Molecular Formula | C21H22BrN5O2S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-(4-bromophenyl)-2-(carbamothioylhydrazinylidene)-7-(diethylamino)chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccc(Br)cc3)c(=NNC(N)=S)oc2c1 |
| InChI | InChI=1S/C21H22BrN5O2S/c1-3-27(4-2)16-10-5-13-11-17(19(28)24-15-8-6-14(22)7-9-15)20(25-26-21(23)30)29-18(13)12-16/h5-12H,3-4H2,1-2H3,(H,24,28)(H3,23,26,30) |
| InChIKey | PNOZLXUUDGCDHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|