C25H29N3O5S — CID 1152121
N-[4-(cyclopentylsulfamoyl)phenyl]-7-(diethylamino)-2-oxochromene-3-carboxamide (PubChem CID 1152121) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[4-(cyclopentylsulfamoyl)phenyl]-7-(diethylamino)-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-(cyclopentylsulfamoyl)phenyl]-7-(diethylamino)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1152121 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[4-(cyclopentylsulfamoyl)phenyl]-7-(diethylamino)-2-oxochromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccc(S(=O)(=O)NC4CCCC4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H29N3O5S/c1-3-28(4-2)20-12-9-17-15-22(25(30)33-23(17)16-20)24(29)26-18-10-13-21(14-11-18)34(31,32)27-19-7-5-6-8-19/h9-16,19,27H,3-8H2,1-2H3,(H,26,29) |
| InChIKey | GAAFXNXSMCXTGX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|