C21H23N3O3 — CID 5134370
7-(diethylamino)-2-hydroxyimino-N-(4-methylphenyl)chromene-3-carboxamide (PubChem CID 5134370) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 7-(diethylamino)-2-hydroxyimino-N-(4-methylphenyl)chromene-3-carboxamide.
| Compound Name | 7-(diethylamino)-2-hydroxyimino-N-(4-methylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 5134370 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 7-(diethylamino)-2-hydroxyimino-N-(4-methylphenyl)chromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccc(C)cc3)c(=NO)oc2c1 |
| InChI | InChI=1S/C21H23N3O3/c1-4-24(5-2)17-11-8-15-12-18(21(23-26)27-19(15)13-17)20(25)22-16-9-6-14(3)7-10-16/h6-13,26H,4-5H2,1-3H3,(H,22,25) |
| InChIKey | CIRBKLHCEYISPD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|