C19H23NO3S — CID 139711899
7-(diethylamino)-3-(thiane-2-carbonyl)chromen-2-one (PubChem CID 139711899) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 7-(diethylamino)-3-(thiane-2-carbonyl)chromen-2-one.
| Compound Name | 7-(diethylamino)-3-(thiane-2-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 139711899 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 7-(diethylamino)-3-(thiane-2-carbonyl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(C(=O)C3CCCCS3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H23NO3S/c1-3-20(4-2)14-9-8-13-11-15(19(22)23-16(13)12-14)18(21)17-7-5-6-10-24-17/h8-9,11-12,17H,3-7,10H2,1-2H3 |
| InChIKey | OKLRPELHJDGUDG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|