C23H21NO5 — CID 78626318
4-[3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 78626318) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 4-[3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 78626318 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[3-[7-(diethylamino)-2-oxochromen-3-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CCN(CC)c1ccc2cc(C(=O)C=Cc3ccc(C(=O)O)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H21NO5/c1-3-24(4-2)18-11-10-17-13-19(23(28)29-21(17)14-18)20(25)12-7-15-5-8-16(9-6-15)22(26)27/h5-14H,3-4H2,1-2H3,(H,26,27) |
| InChIKey | AQIDVAPJLWIHIQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|